Straipsnis iš Vikipedijos, laisvosios enciklopedijos.
Peršokti į: navigacija, paiešką
Nikotinamido adenino dinukleotido fosfatas
NADP+ phys.svg
Sisteminis (IUPAC) pavadinimas
Cheminė formulė C21H29N7O17P3
Molinė masė
SMILES C1=CC(=C[N+](=C1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)N4C=NC5=C4N=CN=C5N)OP(=O)(O)O)O)O)O)C(=O)N
Rūgštingumas (pKa)
Bazingumas (pKb)
Fizinė informacija
Lydymosi t°
Virimo t°
Lūžio rodiklis (nD)
Tirpumas H2O
Šiluminis laidumas
log P
Garavimo slėgis
Kritinis santykinis drėgnumas
Farmakokinetinė informacija
ES klasifikacija
NFPA 704
Žybsnio t°
Užsiliepsnojimo t°
Kristalinė struktūra
Molekulinė forma
Dipolio momentas
Simetrijos grupė
Giminingi junginiai
Giminingi junginiai
Giminingos grupės

Nikotinamido adenino dinukleotido fosfatas (NADP) – oksidacijos – redukcijos procesuose dalyvaujantis kofermentas. Junginys turi oksiduotą (NADP+) ir redukuotą (NADPH) formas. Ląstelė redukuoja NADP+ ir H+ iki NADPH panaudodama du elektronus iš kokio nors didelio energijos šaltinio (pavyzdžiui, NADP+ užsibaigia fotosintezės elektronų transporto grandinės). Susidaręs NADPH gali būti panaudotas ląstelės vykdomose redukcijos reakcijose. Pavyzdžiui, Kalvino cikle fotosintezės metu per tarpines grandis taip redukuojama oro anglies dvideginio anglis:

6 CO2 + 12 NADPH + 12 H2O + 18 ATP → C6H12O6 + 12 NADP+ + 18 ADP + 18 Pi

Kitas panašus kofermentas yra NAD. Jis skiriasi tik tuo, kad neturi fosforo rūgšties liekanos.