Argininas

Straipsnis iš Vikipedijos, laisvosios enciklopedijos.
Peršokti į: navigaciją, paiešką
Argininas
Arginin - Arginine.svg L-arginine-3D-hztl.png
Sisteminis (IUPAC) pavadinimas
Argininas
2-amino-5-guanidinpentano rūgštis,
Arg
Identifikacija
CAS numeris 74-79-3
PubChem 6322
ChemSpider 227
Cheminė informacija
Cheminė formulė C6H14N4O2
Molinė masė 174,2 g mol−1
SMILES N[C@@H](CCCNC(N)=N)C(O)=O
Rūgštingumas (pKa)
Bazingumas (pKb)
Valentingumas
Fizinė informacija
Tankis
Išvaizda
Lydymosi t°
Virimo t°
Lūžio rodiklis (nD)
Klampumas
Tirpumas H2O
Šiluminis laidumas
log P
Garavimo slėgis
kH
Kritinis santykinis drėgnumas
Farmakokinetinė informacija
Biotinkamumas
Metabolizmas
Pusamžis
Pavojus
MSDS
ES klasifikacija
NFPA 704
Žybsnio t°
Užsiliepsnojimo t°
R-frazės
S-frazės
LD50
Struktūra
Kristalinė struktūra
Molekulinė forma
Dipolio momentas
Simetrijos grupė
Termochemija
ΔfHo298
Giminingi junginiai
Giminingi grupė
Giminingi junginiai
Giminingos grupės

Argininas (Arg) - viena iš dvidešimties dažniausių aminorūgščių Žemėje.


Aminorūgšys

Alaninas | Argininas | Asparaginas | Asparto rūgštis | Cisteinas

Fenilalaninas | Glicinas | Glutaminas | Glutamo rūgštis | Histidinas | Izoleucinas | Leucinas | Lizinas | Metioninas | Prolinas | Serinas | Tirozinas | Treoninas | Triptofanas | Valinas

Baltymas | Polipeptidas | Genetinis kodas